smiles stringlengths 9 232 | admet_ai.molecular_weight float64 150 999 | admet_ai.logP float64 -8.87 14.6 | admet_ai.hydrogen_bond_acceptors float64 0 26 | admet_ai.hydrogen_bond_donors float64 0 17 | admet_ai.Lipinski float64 0 4 | admet_ai.QED float64 0.01 0.95 | admet_ai.stereo_centers float64 0 29 | admet_ai.tpsa float64 0 497 | admet_ai.AMES float64 0 1 | admet_ai.BBB_Martins float64 0.01 1 | admet_ai.Bioavailability_Ma float64 0.03 1 | admet_ai.CYP1A2_Veith float64 0 1 | admet_ai.CYP2C19_Veith float64 0 1 | admet_ai.CYP2C9_Substrate_CarbonMangels float64 0 0.93 | admet_ai.CYP2C9_Veith float64 0 1 | admet_ai.CYP2D6_Substrate_CarbonMangels float64 0 0.96 | admet_ai.CYP2D6_Veith float64 0 1 | admet_ai.CYP3A4_Substrate_CarbonMangels float64 0.01 0.98 | admet_ai.CYP3A4_Veith float64 0 1 | admet_ai.Carcinogens_Lagunin float64 0 0.97 | admet_ai.ClinTox float64 0 0.97 | admet_ai.DILI float64 0 1 | admet_ai.HIA_Hou float64 0 1 | admet_ai.NR-AR-LBD float64 0 0.99 | admet_ai.NR-AR float64 0 1 | admet_ai.NR-AhR float64 0 1 | admet_ai.NR-Aromatase float64 0 0.97 | admet_ai.NR-ER-LBD float64 0 0.99 | admet_ai.NR-ER float64 0 0.99 | admet_ai.NR-PPAR-gamma float64 0 0.91 | admet_ai.PAMPA_NCATS float64 0 1 | admet_ai.Pgp_Broccatelli float64 0 1 | admet_ai.SR-ARE float64 0 0.99 | admet_ai.SR-ATAD5 float64 0 0.95 | admet_ai.SR-HSE float64 0 0.94 | admet_ai.SR-MMP float64 0 1 | admet_ai.SR-p53 float64 0 0.95 | admet_ai.Skin_Reaction float64 0.02 1 | admet_ai.hERG float64 0 1 | admet_ai.Caco2_Wang float64 -8.17 -3.31 | admet_ai.Clearance_Hepatocyte_AZ float64 -96.1 214 | admet_ai.Clearance_Microsome_AZ float64 -97.26 179 | admet_ai.Half_Life_Obach float64 -101.02 501 | admet_ai.HydrationFreeEnergy_FreeSolv float64 -25 3.06 | admet_ai.LD50_Zhu float64 0.64 7.61 | admet_ai.Lipophilicity_AstraZeneca float64 -5.48 5.97 | admet_ai.PPBR_AZ float64 -71.93 121 | admet_ai.Solubility_AqSolDB float64 -9.2 1.88 | admet_ai.VDss_Lombardo float64 -24.1 168 | admet_ai.molecular_weight_drugbank_approved_percentile float64 9.5 96.4 | admet_ai.logP_drugbank_approved_percentile float64 1.94 99.9 | admet_ai.hydrogen_bond_acceptors_drugbank_approved_percentile float64 1.94 99 | admet_ai.hydrogen_bond_donors_drugbank_approved_percentile float64 11.8 98.6 | admet_ai.Lipinski_drugbank_approved_percentile float64 0.19 63.8 | admet_ai.QED_drugbank_approved_percentile float64 0 100 | admet_ai.stereo_centers_drugbank_approved_percentile float64 22.5 99.7 | admet_ai.tpsa_drugbank_approved_percentile float64 1.8 98.2 | admet_ai.AMES_drugbank_approved_percentile float64 0.27 99.9 | admet_ai.BBB_Martins_drugbank_approved_percentile float64 0 99.8 | admet_ai.Bioavailability_Ma_drugbank_approved_percentile float64 0.12 100 | admet_ai.CYP1A2_Veith_drugbank_approved_percentile float64 0.12 100 | admet_ai.CYP2C19_Veith_drugbank_approved_percentile float64 0.16 100 | admet_ai.CYP2C9_Substrate_CarbonMangels_drugbank_approved_percentile float64 0.23 100 | admet_ai.CYP2C9_Veith_drugbank_approved_percentile float64 0 100 | admet_ai.CYP2D6_Substrate_CarbonMangels_drugbank_approved_percentile float64 0.12 100 | admet_ai.CYP2D6_Veith_drugbank_approved_percentile float64 0.16 100 | admet_ai.CYP3A4_Substrate_CarbonMangels_drugbank_approved_percentile float64 0.16 100 | admet_ai.CYP3A4_Veith_drugbank_approved_percentile float64 0.12 100 | admet_ai.Carcinogens_Lagunin_drugbank_approved_percentile float64 0 100 | admet_ai.ClinTox_drugbank_approved_percentile float64 0 100 | admet_ai.DILI_drugbank_approved_percentile float64 0 100 | admet_ai.HIA_Hou_drugbank_approved_percentile float64 0 100 | admet_ai.NR-AR-LBD_drugbank_approved_percentile float64 0 100 | admet_ai.NR-AR_drugbank_approved_percentile float64 0.08 100 | admet_ai.NR-AhR_drugbank_approved_percentile float64 0 100 | admet_ai.NR-Aromatase_drugbank_approved_percentile float64 0.43 100 | admet_ai.NR-ER-LBD_drugbank_approved_percentile float64 0.81 100 | admet_ai.NR-ER_drugbank_approved_percentile float64 1.47 99.9 | admet_ai.NR-PPAR-gamma_drugbank_approved_percentile float64 0.47 100 | admet_ai.PAMPA_NCATS_drugbank_approved_percentile float64 0 100 | admet_ai.Pgp_Broccatelli_drugbank_approved_percentile float64 0.04 100 | admet_ai.SR-ARE_drugbank_approved_percentile float64 0.04 100 | admet_ai.SR-ATAD5_drugbank_approved_percentile float64 0 100 | admet_ai.SR-HSE_drugbank_approved_percentile float64 0.12 99.9 | admet_ai.SR-MMP_drugbank_approved_percentile float64 0 100 | admet_ai.SR-p53_drugbank_approved_percentile float64 0 100 | admet_ai.Skin_Reaction_drugbank_approved_percentile float64 0.31 99.9 | admet_ai.hERG_drugbank_approved_percentile float64 0.16 100 | admet_ai.Caco2_Wang_drugbank_approved_percentile float64 0.08 100 | admet_ai.Clearance_Hepatocyte_AZ_drugbank_approved_percentile float64 0.16 100 | admet_ai.Clearance_Microsome_AZ_drugbank_approved_percentile float64 0.16 100 | admet_ai.Half_Life_Obach_drugbank_approved_percentile float64 0 100 | admet_ai.HydrationFreeEnergy_FreeSolv_drugbank_approved_percentile float64 0.04 99.8 | admet_ai.LD50_Zhu_drugbank_approved_percentile float64 0.19 100 | admet_ai.Lipophilicity_AstraZeneca_drugbank_approved_percentile float64 0.08 100 | admet_ai.PPBR_AZ_drugbank_approved_percentile float64 0.23 100 | admet_ai.Solubility_AqSolDB_drugbank_approved_percentile float64 0.08 99.8 | admet_ai.VDss_Lombardo_drugbank_approved_percentile float64 0 100 | similarity.similar_compounds listlengths 0 5 ⌀ | similarity.count float64 0 5 ⌀ | rdkit_properties.RotatableBondCount int64 0 42 | rdkit_properties.HBondDonorCount int64 0 17 | rdkit_properties.HBondAcceptorCount int64 0 26 | rdkit_properties.TPSA float64 0 497 | rdkit_properties.LogP float64 -8.87 14.6 | rdkit_properties.MolarRefractivity float64 17.5 290 | rdkit_properties.SlogP_VSA5 float64 0 223 | rdkit_properties.RingCount int64 0 16 | rdkit_properties.AromaticRingCount int64 0 12 | rdkit_properties.FractionCSP3 float64 0 1 | rdkit_properties.HeavyAtomCount int64 6 73 | rdkit_properties.MolWt float64 150 999 | rdkit_properties.AccessibleSurfaceArea float64 45.1 427 | rdkit_properties.FormalCharge int64 -3 4 | rdkit_properties.BasicAmineCount int64 0 8 | rdkit_properties.PEOE_VSA6 float64 0 231 | rdkit_properties.Kappa1 float64 4.6 61.2 | rdkit_properties.BalabanJ float64 0.57 7.03 | rdkit_properties.BertzCT float64 36.8 4.14k | rdkit_properties.QED float64 0.01 0.95 | rdkit_properties.SyntheticAccessibility float64 1 7.79 | rdkit_properties.PAINS bool 2 classes | rdkit_properties.LipinskiViolations int64 0 4 | rdkit_properties.MurckoScaffold stringlengths 0 140 | similarity.error stringclasses 1 value |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
CC(C)(C)c1ccc2occ(CC(=O)Nc3ccccc3F)c2c1 | 325.383 | 5.0506 | 2 | 1 | 3 | 0.731901 | 0 | 42.24 | 0.186365 | 0.945895 | 0.805833 | 0.916196 | 0.984722 | 0.452649 | 0.779245 | 0.149415 | 0.362425 | 0.739862 | 0.690061 | 0.392971 | 0.028546 | 0.822334 | 0.999974 | 0.005689 | 0.019229 | 0.558858 | 0.537933 | 0.045519 | 0.237866 | 0.071073 | 0.978555 | 0.620766 | 0.740198 | 0.052941 | 0.144542 | 0.844529 | 0.104147 | 0.324776 | 0.836627 | -4.501858 | 91.682257 | 88.645652 | 132.315441 | -8.138623 | 3.106783 | 4.351448 | 106.143253 | -5.215913 | 6.560665 | 48.080651 | 89.026755 | 16.382319 | 36.680884 | 20.918961 | 79.216751 | 22.489337 | 24.89337 | 49.747964 | 75.222955 | 51.6867 | 95.81233 | 99.457154 | 90.810392 | 96.277627 | 59.015122 | 81.737107 | 78.867778 | 87.049244 | 81.930981 | 25.126018 | 73.439318 | 93.0981 | 34.625824 | 43.427685 | 93.912369 | 97.518418 | 74.718883 | 83.947266 | 88.057387 | 91.547111 | 80.767739 | 94.261342 | 80.845289 | 88.949205 | 96.393951 | 75.959674 | 38.270648 | 80.728965 | 80.341218 | 87.669639 | 93.408298 | 97.324544 | 65.141528 | 83.365646 | 97.557193 | 97.634742 | 11.516092 | 82.241179 | [
{
"HBA": 2,
"HBD": 1,
"LogP": 5.1952000000000025,
"MW": 347.336,
"TPSA": 42.24,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1724368",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5666666666666667,
"smiles": "CCc1ccc2occ(CC(=O)Nc3ccccc3C(F)(F)F)c2c1",
"source": "ChEMBL",
"standard_inchi_key": "YHCVYEQJHOAWDY-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 1,
"LogP": 4.321120000000003,
"MW": 309.365,
"TPSA": 51.47,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1528796",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5245901639344263,
"smiles": "CCOc1ccccc1NC(=O)Cc1coc2ccc(C)cc12",
"source": "ChEMBL",
"standard_inchi_key": "FVNHDXYYMYFXRI-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 2 | 3 | 1 | 2 | 42.24 | 5.051 | 93.648 | 31.898 | 3 | 3 | 0.25 | 24 | 325.383 | 140.031 | 0 | 0 | 38.97 | 16.245 | 1.844 | 890.035 | 0.732 | 2.084 | false | 1 | O=C(Cc1coc2ccccc12)Nc1ccccc1 | null |
C[C@@H]1CC(Nc2cncc(-c3nncn3C)c2)C[C@@H](C)C1 | 285.395 | 3.1137 | 5 | 1 | 4 | 0.941112 | 2 | 55.63 | 0.279737 | 0.919407 | 0.986449 | 0.490267 | 0.487715 | 0.414109 | 0.1268 | 0.257576 | 0.033648 | 0.5859 | 0.852218 | 0.074691 | 0.148535 | 0.632898 | 0.999997 | 0.002349 | 0.014597 | 0.428316 | 0.234343 | 0.026595 | 0.150152 | 0.006484 | 0.987395 | 0.110034 | 0.233742 | 0.067134 | 0.063829 | 0.083973 | 0.011732 | 0.286325 | 0.170723 | -4.734604 | 41.288199 | 19.946996 | 29.619744 | -7.005614 | 2.667687 | 3.040306 | 83.734095 | -3.134699 | 4.119598 | 36.331912 | 63.319116 | 59.112059 | 36.680884 | 63.8038 | 100 | 68.863901 | 34.703373 | 63.978286 | 70.492439 | 99.224506 | 82.706475 | 83.40442 | 88.406359 | 69.212873 | 71.267933 | 44.048081 | 58.898798 | 92.826677 | 29.352462 | 59.829391 | 61.108957 | 98.487786 | 18.805739 | 35.129895 | 91.198139 | 87.553315 | 61.419155 | 71.07406 | 54.711128 | 95.81233 | 52.888717 | 64.908879 | 83.326871 | 78.596355 | 61.225281 | 40.67468 | 33.85033 | 39.317565 | 65.4905 | 54.788678 | 52.733618 | 75.494378 | 74.912757 | 59.98449 | 81.775882 | 61.651803 | 48.196976 | 68.786351 | [] | 0 | 3 | 1 | 5 | 55.63 | 3.114 | 83.824 | 33.11 | 3 | 2 | 0.562 | 21 | 285.395 | 125.364 | 0 | 1 | 13.847 | 14.045 | 1.76 | 596.22 | 0.941 | 3.432 | false | 0 | c1nnc(-c2cncc(NC3CCCCC3)c2)[nH]1 | null |
N#Cc1ccc(-c2ccc(O[C@@H](C(=O)N3CCCC3)c3ccccc3)cc2)cc1 | 382.463 | 4.96778 | 3 | 0 | 4 | 0.626105 | 1 | 53.33 | 0.402399 | 0.572064 | 0.911399 | 0.112275 | 0.318069 | 0.495576 | 0.512004 | 0.347273 | 0.006277 | 0.804396 | 0.458457 | 0.506981 | 0.260631 | 0.929394 | 0.996917 | 0.019712 | 0.035828 | 0.233733 | 0.145983 | 0.046601 | 0.191642 | 0.036574 | 0.923307 | 0.775833 | 0.72014 | 0.059753 | 0.034623 | 0.635654 | 0.179169 | 0.200899 | 0.881042 | -4.665933 | 90.781018 | 55.582342 | 7.078218 | -8.857324 | 3.405186 | 3.576178 | 95.349229 | -6.301073 | 2.40944 | 60.992633 | 88.367584 | 31.174874 | 11.768127 | 63.8038 | 64.017061 | 54.808065 | 33.152385 | 76.347421 | 35.323769 | 77.084141 | 61.884451 | 73.594416 | 93.059325 | 90.577743 | 77.510663 | 19.775107 | 88.290035 | 78.673905 | 88.98798 | 73.012796 | 85.498255 | 53.586661 | 66.188445 | 64.017061 | 83.986041 | 79.95347 | 75.300504 | 78.790229 | 79.837146 | 72.276076 | 87.088019 | 93.563397 | 82.047305 | 68.049632 | 90.538969 | 83.792168 | 20.550601 | 84.645211 | 69.639395 | 87.281892 | 80.884064 | 49.786739 | 57.968205 | 90.694067 | 90.694067 | 83.40442 | 3.295851 | 57.309035 | [
{
"HBA": 3,
"HBD": 0,
"LogP": 2.5807,
"MW": 310.39700000000005,
"TPSA": 32.78,
"activity": 6.619788758288394,
"activity_nm": 240,
"activity_type": "IC50",
"bindingdb_id": "50395970.0",
"chembl_id": "CHEMBL2164900",
"doi": "10.1016/j.bmcl.2012.09.011",
"drugbank_id": null,
"ligand_inchi_key": "HAQRQSQIJNAAOJ-GOSISDBHSA-N",
"pdb_id": null,
"pmid": "23062550.0",
"pubchem_cid": "71456921.0",
"similarity": 0.5510204081632653,
"smiles": "CN1CCN(CC1)C(=O)[C@H](Oc1ccccc1)c1ccccc1",
"source": "BindingDB",
"standard_inchi_key": null,
"target_name": "Muscarinic acetylcholine receptor M1",
"target_organism": null,
"uniprot_id": "P11229"
},
{
"HBA": 3,
"HBD": 0,
"LogP": 2.5807,
"MW": 310.39700000000005,
"TPSA": 32.78,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": "50395984.0",
"chembl_id": "CHEMBL2164901",
"doi": "10.1016/j.bmcl.2012.09.011",
"drugbank_id": null,
"ligand_inchi_key": "HAQRQSQIJNAAOJ-SFHVURJKSA-N",
"pdb_id": null,
"pmid": "23062550.0",
"pubchem_cid": "71460586.0",
"similarity": 0.5510204081632653,
"smiles": "CN1CCN(CC1)C(=O)[C@@H](Oc1ccccc1)c1ccccc1",
"source": "BindingDB",
"standard_inchi_key": null,
"target_name": "Muscarinic acetylcholine receptor M1",
"target_organism": null,
"uniprot_id": "P11229"
},
{
"HBA": 3,
"HBD": 0,
"LogP": 2.5807,
"MW": 310.3970000000001,
"TPSA": 32.78,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2164901",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5510204081632653,
"smiles": "CN1CCN(C(=O)[C@@H](Oc2ccccc2)c2ccccc2)CC1",
"source": "ChEMBL",
"standard_inchi_key": "HAQRQSQIJNAAOJ-SFHVURJKSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 0,
"LogP": 2.5807,
"MW": 310.3970000000001,
"TPSA": 32.78,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2164900",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5510204081632653,
"smiles": "CN1CCN(C(=O)[C@H](Oc2ccccc2)c2ccccc2)CC1",
"source": "ChEMBL",
"standard_inchi_key": "HAQRQSQIJNAAOJ-GOSISDBHSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 4 | 5 | 0 | 3 | 53.33 | 4.968 | 112.218 | 30.073 | 4 | 3 | 0.2 | 29 | 382.463 | 170.522 | 0 | 0 | 54.597 | 18.768 | 1.551 | 999.444 | 0.626 | 2.471 | false | 0 | O=C([C@H](Oc1ccc(-c2ccccc2)cc1)c1ccccc1)N1CCCC1 | null |
CCOC(=O)[C@@H]1CCCN(C(=O)c2nc(-c3ccc(C)cc3)n3c2CCCCC3)C1 | 409.53 | 4.00022 | 5 | 0 | 4 | 0.716225 | 1 | 64.43 | 0.231522 | 0.934095 | 0.735499 | 0.393341 | 0.81425 | 0.269989 | 0.826233 | 0.302802 | 0.114004 | 0.902106 | 0.920882 | 0.038322 | 0.415106 | 0.521035 | 0.999974 | 0.006959 | 0.039304 | 0.120394 | 0.150474 | 0.015573 | 0.090042 | 0.007351 | 0.994787 | 0.970274 | 0.473782 | 0.03762 | 0.078642 | 0.029982 | 0.015667 | 0.348527 | 0.925189 | -4.732876 | 81.078683 | 101.163286 | -9.012657 | -7.274864 | 2.448952 | 3.747465 | 93.796054 | -4.757236 | 1.599733 | 67.351687 | 77.394339 | 59.112059 | 11.768127 | 63.8038 | 77.045366 | 54.808065 | 42.574641 | 57.19271 | 72.780147 | 41.33385 | 79.720822 | 94.649089 | 73.982164 | 97.014347 | 74.796433 | 64.366033 | 98.487786 | 95.734781 | 15.975184 | 84.024816 | 55.021326 | 93.0981 | 39.123691 | 67.002714 | 74.408686 | 80.418767 | 46.645987 | 50.794882 | 56.262117 | 99.418379 | 98.487786 | 82.435052 | 76.929042 | 81.698333 | 47.305157 | 45.056223 | 41.295076 | 89.841024 | 65.529275 | 83.016673 | 95.967429 | 20.62815 | 73.05157 | 44.707251 | 92.865452 | 80.612641 | 17.720047 | 50.911206 | [
{
"HBA": 5,
"HBD": 0,
"LogP": 3.0653200000000016,
"MW": 342.3950000000001,
"TPSA": 72.64,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1537169",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.609375,
"smiles": "CCOC(=O)C1CCCN(C(=O)c2cc(-c3ccc(C)cc3)on2)C1",
"source": "ChEMBL",
"standard_inchi_key": "YPNBBSPAPLQAFB-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 8,
"HBD": 0,
"LogP": 0.6549200000000002,
"MW": 400.43500000000023,
"TPSA": 103.5,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1314767",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5735294117647058,
"smiles": "CCOC(=O)C1CCCN(C(=O)c2nn(-c3ccc(C)cc3)c(=O)n(C)c2=O)C1",
"source": "ChEMBL",
"standard_inchi_key": "YCEGXCAIJSZZMQ-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 0,
"LogP": 2.33922,
"MW": 289.375,
"TPSA": 46.61,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1409410",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5666666666666667,
"smiles": "CCOC(=O)C1CCCN(C(=O)Cc2ccc(C)cc2)C1",
"source": "ChEMBL",
"standard_inchi_key": "WWTZFCFILGVGIK-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 0,
"LogP": 4.625520000000004,
"MW": 402.49400000000014,
"TPSA": 59.5,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1385824",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5571428571428572,
"smiles": "CCOC(=O)C1CCCN(C(=O)c2cc(-c3ccc(C)cc3)nc3ccccc23)C1",
"source": "ChEMBL",
"standard_inchi_key": "FTZLPFMJGUEJMY-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 1,
"LogP": 2.11592,
"MW": 291.34700000000004,
"TPSA": 66.84,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1504078",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5396825396825397,
"smiles": "CCOC(=O)C1CCCN(C(=O)c2ccc(C)cc2O)C1",
"source": "ChEMBL",
"standard_inchi_key": "QARQYDLAFMZYSL-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 4 | 0 | 5 | 64.43 | 4 | 115.216 | 60.774 | 4 | 2 | 0.542 | 30 | 409.53 | 177.786 | 0 | 0 | 36.25 | 20.635 | 1.652 | 916.523 | 0.716 | 2.823 | false | 0 | O=C(c1nc(-c2ccccc2)n2c1CCCCC2)N1CCCCC1 | null |
N#CC1=C(SCC(=O)Nc2cccc(Cl)c2)N=C([O-])[C@H](C#N)C12CCCCC2 | 413.91 | 3.60956 | 6 | 1 | 4 | 0.809572 | 1 | 112.1 | 0.136718 | 0.810686 | 0.800666 | 0.403146 | 0.944201 | 0.282058 | 0.856399 | 0.045689 | 0.360677 | 0.755489 | 0.885373 | 0.437789 | 0.055639 | 0.833819 | 0.999916 | 0.008644 | 0.008757 | 0.197065 | 0.420518 | 0.032063 | 0.094454 | 0.191159 | 0.876478 | 0.420481 | 0.805588 | 0.095373 | 0.371256 | 0.972551 | 0.560381 | 0.617703 | 0.477075 | -4.786218 | 68.884265 | 75.59396 | 24.823978 | -7.462989 | 2.815183 | 3.161551 | 97.306821 | -6.053793 | -1.393629 | 68.359829 | 71.384257 | 69.503684 | 36.680884 | 63.8038 | 90.461419 | 54.808065 | 74.059713 | 41.450174 | 56.804963 | 51.02753 | 80.224893 | 97.828616 | 75.533152 | 97.595967 | 31.795269 | 81.737107 | 81.504459 | 94.532765 | 84.994184 | 38.891043 | 74.873982 | 86.27375 | 43.931756 | 22.295463 | 81.504459 | 95.463358 | 66.498643 | 52.966266 | 94.998061 | 63.008918 | 72.004653 | 96.083753 | 87.785964 | 95.657231 | 99.495929 | 97.091896 | 68.088406 | 62.310973 | 62.388523 | 76.308647 | 89.336952 | 71.539356 | 71.539356 | 68.980225 | 84.179915 | 86.85537 | 5.001939 | 25.630089 | [] | 0 | 4 | 1 | 6 | 112.1 | 3.61 | 107.235 | 32.104 | 3 | 1 | 0.4 | 28 | 413.91 | 172.452 | -1 | 0 | 48.692 | 20.259 | 1.801 | 922.869 | 0.81 | 4.035 | false | 0 | O=C(CSC1=CC2(CC=N1)CCCCC2)Nc1ccccc1 | null |
CC[NH+](CC)[C@](C)(CC)[C@H](O)c1cscc1Br | 321.304 | 2.6374 | 2 | 2 | 4 | 0.82715 | 2 | 24.67 | 0.020317 | 0.448308 | 0.478946 | 0.092509 | 0.033554 | 0.088501 | 0.003338 | 0.363083 | 0.705971 | 0.230227 | 0.076165 | 0.087624 | 0.005418 | 0.004029 | 0.793576 | 0.001995 | 0.012646 | 0.003857 | 0.008062 | 0.006039 | 0.078877 | 0.000067 | 0.64128 | 0.015989 | 0.014942 | 0.000093 | 0.000726 | 0.007308 | 0.000518 | 0.811723 | 0.48325 | -5.022571 | 71.046316 | 7.048601 | 145.409252 | -11.569697 | 3.17421 | 0.399664 | 28.583392 | -1.414108 | 61.406148 | 47.227608 | 56.029469 | 16.382319 | 60.856921 | 63.8038 | 92.322606 | 68.863901 | 12.252811 | 8.142691 | 27.491276 | 18.340442 | 59.053897 | 31.71772 | 32.260566 | 18.262893 | 78.480031 | 90.538969 | 26.560682 | 51.919349 | 33.811555 | 8.491663 | 1.357115 | 22.566886 | 16.750679 | 30.632028 | 22.062815 | 35.750291 | 25.009694 | 44.707251 | 7.716169 | 41.799147 | 29.352462 | 13.532377 | 6.9019 | 7.832493 | 30.205506 | 8.29779 | 85.343156 | 62.582396 | 47.692904 | 77.588212 | 37.184955 | 97.595967 | 31.174874 | 85.886002 | 32.958511 | 8.879411 | 77.433114 | 99.883676 | [] | 0 | 6 | 2 | 2 | 24.67 | 2.637 | 77.72 | 45.783 | 1 | 1 | 0.692 | 17 | 321.304 | 116.778 | 1 | 0 | 6.924 | 15.158 | 3.045 | 350.944 | 0.827 | 5.091 | false | 0 | c1ccsc1 | null |
COc1ccc(C(=O)N(C)[C@@H](C)C/C(N)=N/O)cc1O | 281.312 | 0.9978 | 5 | 3 | 4 | 0.322732 | 1 | 108.38 | 0.421088 | 0.667989 | 0.669572 | 0.110572 | 0.075991 | 0.148274 | 0.031067 | 0.295447 | 0.084574 | 0.376951 | 0.191417 | 0.090566 | 0.060422 | 0.047535 | 0.995187 | 0.005278 | 0.010878 | 0.07001 | 0.024572 | 0.04588 | 0.073904 | 0.001555 | 0.536108 | 0.059467 | 0.022853 | 0.003518 | 0.018806 | 0.012595 | 0.005348 | 0.544976 | 0.349274 | -5.453113 | 60.241929 | -9.312456 | -1.661522 | -13.064255 | 2.273017 | -0.103057 | 43.649209 | -0.586894 | -4.600504 | 35.246219 | 32.764637 | 59.112059 | 77.258627 | 63.8038 | 24.0791 | 54.808065 | 72.276076 | 77.549438 | 43.776658 | 31.950368 | 61.651803 | 44.668476 | 50.135712 | 47.266382 | 74.292361 | 59.015122 | 39.588988 | 65.102753 | 34.664599 | 40.67468 | 11.632416 | 48.856146 | 32.803412 | 26.909655 | 66.343544 | 49.476541 | 74.873982 | 41.876696 | 31.136099 | 35.789066 | 45.366421 | 18.107794 | 39.93796 | 56.417216 | 36.331912 | 29.00349 | 62.03955 | 54.827453 | 25.126018 | 70.531214 | 17.099651 | 33.346258 | 20.007755 | 34.044203 | 24.544397 | 16.867003 | 88.018612 | 9.965103 | [
{
"HBA": 4,
"HBD": 2,
"LogP": 0.9973999999999996,
"MW": 280.324,
"TPSA": 78.87,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4558794",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5555555555555556,
"smiles": "CNC(=O)CC(C)N(C)C(=O)c1ccc(O)c(OC)c1",
"source": "ChEMBL",
"standard_inchi_key": "AVXFQJKHGGDGCA-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 1,
"LogP": 1.8827999999999998,
"MW": 223.272,
"TPSA": 49.77,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": null,
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5102040816326531,
"smiles": "CCN(CC)C(=O)c1ccc(OC)c(O)c1",
"source": "PubChem",
"standard_inchi_key": null,
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 2,
"LogP": 0.49970000000000003,
"MW": 167.164,
"TPSA": 72.55,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": null,
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5,
"smiles": "COc1ccc(C(N)=O)cc1O",
"source": "PubChem",
"standard_inchi_key": null,
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 3 | 5 | 3 | 5 | 108.38 | 0.998 | 74.24 | 23.703 | 1 | 1 | 0.385 | 20 | 281.312 | 116.799 | 0 | 1 | 5.156 | 15.617 | 2.858 | 516.338 | 0.323 | 2.852 | false | 0 | c1ccccc1 | null |
O=C(Nc1nc[nH]n1)c1cccnc1Nc1cccc(F)c1 | 298.281 | 2.3347 | 5 | 3 | 4 | 0.686787 | 0 | 95.59 | 0.631826 | 0.690312 | 0.97724 | 0.67869 | 0.322516 | 0.400212 | 0.265026 | 0.131725 | 0.142293 | 0.421184 | 0.396519 | 0.367341 | 0.450737 | 0.977098 | 0.999638 | 0.011841 | 0.023989 | 0.765736 | 0.075072 | 0.026046 | 0.266472 | 0.008722 | 0.726495 | 0.028273 | 0.329029 | 0.277412 | 0.05183 | 0.49188 | 0.278652 | 0.413752 | 0.329736 | -5.11922 | 59.67594 | 2.11499 | 22.92465 | -15.536588 | 2.725618 | 1.64416 | 77.969402 | -3.927095 | 4.793365 | 39.860411 | 50.213261 | 59.112059 | 77.258627 | 63.8038 | 72.586274 | 22.489337 | 64.715006 | 89.336952 | 45.909267 | 97.402094 | 88.32881 | 74.059713 | 87.436991 | 80.418767 | 56.029469 | 68.243505 | 43.931756 | 76.308647 | 79.682047 | 85.614579 | 96.54905 | 75.649477 | 52.927491 | 50.135712 | 97.440869 | 68.010857 | 61.031408 | 86.1962 | 59.053897 | 47.964327 | 35.750291 | 73.322993 | 96.355176 | 75.339279 | 85.226832 | 89.453276 | 49.088794 | 53.237689 | 41.372625 | 70.182241 | 30.981 | 69.445522 | 8.103916 | 63.319116 | 53.276464 | 53.625436 | 33.385033 | 73.284219 | [
{
"HBA": 3,
"HBD": 2,
"LogP": 2.0632,
"MW": 231.23,
"TPSA": 68.01,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1576412",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6078431372549019,
"smiles": "NC(=O)c1cccnc1Nc1cccc(F)c1",
"source": "ChEMBL",
"standard_inchi_key": "QYIHDPWCKNIVLP-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 2,
"LogP": 1.1961,
"MW": 206.18,
"TPSA": 70.67,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1561012",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5882352941176471,
"smiles": "O=C(Nc1nc[nH]n1)c1cccc(F)c1",
"source": "ChEMBL",
"standard_inchi_key": "AQERYHSAKUBTEX-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 2,
"LogP": 1.1054,
"MW": 223.62300000000002,
"TPSA": 83.56,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1727313",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5576923076923077,
"smiles": "O=C(Nc1nc[nH]n1)c1cccnc1Cl",
"source": "ChEMBL",
"standard_inchi_key": "KWQLQUCRXPNBLH-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 3,
"LogP": 1.7526999999999997,
"MW": 237.26300000000003,
"TPSA": 65.63,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2063618",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5471698113207547,
"smiles": "Fc1cccc(NC(=S)Nc2nc[nH]n2)c1",
"source": "ChEMBL",
"standard_inchi_key": "BKNBHKFAWTTYOT-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 1,
"LogP": 5.340100000000003,
"MW": 390.336,
"TPSA": 51.22,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL5309418",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5396825396825397,
"smiles": "O=C(OCc1ccccc1C(F)(F)F)c1cccnc1Nc1cccc(F)c1",
"source": "ChEMBL",
"standard_inchi_key": "GUTUETUWIKWTCM-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 4 | 3 | 5 | 95.59 | 2.335 | 78.256 | 10.358 | 3 | 3 | 0 | 22 | 298.281 | 124.174 | 0 | 1 | 6.066 | 13.682 | 1.845 | 789.542 | 0.687 | 2.628 | false | 0 | O=C(Nc1nc[nH]n1)c1cccnc1Nc1ccccc1 | null |
Cc1c(/C=N/c2cc(Br)ccn2)c(O)n2c(nc3ccccc32)c1C#N | 406.243 | 4.2813 | 6 | 1 | 4 | 0.503697 | 0 | 86.57 | 0.449318 | 0.700031 | 0.847135 | 0.875197 | 0.507514 | 0.318322 | 0.612764 | 0.105772 | 0.255612 | 0.645262 | 0.257703 | 0.099379 | 0.090257 | 0.94626 | 0.999883 | 0.080475 | 0.041673 | 0.933236 | 0.589804 | 0.088482 | 0.170542 | 0.151875 | 0.950928 | 0.891183 | 0.86789 | 0.508563 | 0.257762 | 0.895352 | 0.755525 | 0.410063 | 0.801225 | -4.871231 | 36.136063 | 64.150359 | -17.847905 | -10.251487 | 2.853276 | 2.708895 | 103.897637 | -5.22095 | -5.674098 | 66.653742 | 81.737107 | 69.503684 | 36.680884 | 63.8038 | 47.537805 | 22.489337 | 58.433501 | 79.526948 | 46.413339 | 59.98449 | 94.222567 | 84.179915 | 80.108569 | 92.981776 | 50.213261 | 76.618845 | 66.459868 | 69.833269 | 36.991082 | 48.701047 | 88.290035 | 84.296239 | 89.026755 | 68.631252 | 99.302055 | 97.906165 | 86.428848 | 74.718883 | 93.75727 | 80.263668 | 92.865452 | 97.828616 | 98.836758 | 93.718496 | 97.557193 | 99.069407 | 48.584723 | 78.363707 | 56.882513 | 50.174486 | 84.761535 | 9.771229 | 44.048081 | 70.957736 | 74.176037 | 95.773556 | 11.516092 | 6.630477 | [
{
"HBA": 6,
"HBD": 1,
"LogP": 4.132400000000003,
"MW": 356.38500000000005,
"TPSA": 82.91,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL3195708",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6212121212121212,
"smiles": "COc1ccccc1/N=C/c1c(C)c(C#N)c2nc3ccccc3n2c1O",
"source": "ChEMBL",
"standard_inchi_key": "JMZBDXCPYBTTHJ-FSJBWODESA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 5,
"HBD": 1,
"LogP": 4.686200000000005,
"MW": 354.413,
"TPSA": 73.68,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2005553",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6212121212121212,
"smiles": "CCc1ccccc1/N=C/c1c(C)c(C#N)c2nc3ccccc3n2c1O",
"source": "ChEMBL",
"standard_inchi_key": "HVDDSOSHLXTHSB-ZMOGYAJESA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 5,
"HBD": 1,
"LogP": 2.1856999999999998,
"MW": 251.245,
"TPSA": 78.38999999999999,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1989856",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6,
"smiles": "Cc1c(C=O)c(O)n2c(nc3ccccc32)c1C#N",
"source": "ChEMBL",
"standard_inchi_key": "UPITUWGOTMBQLX-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 9,
"HBD": 3,
"LogP": 1.3322999999999998,
"MW": 333.3150000000001,
"TPSA": 140.17,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL5497187",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5416666666666666,
"smiles": "Cc1c(/C=N\\Nc2nnn[nH]2)c(O)n2c(nc3ccccc32)c1C#N",
"source": "ChEMBL",
"standard_inchi_key": "SXDCLDSTXGMUKA-IDUWFGFVSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 6,
"HBD": 1,
"LogP": 4.941800000000004,
"MW": 486.3290000000002,
"TPSA": 93.99,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2005112",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5394736842105263,
"smiles": "CC1=NN(c2cccc(Br)c2)C(=O)C1=Cc1c(C)c(C#N)c2nc3ccccc3n2c1O",
"source": "ChEMBL",
"standard_inchi_key": "FSANMCKFZIBYGJ-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 2 | 1 | 6 | 86.57 | 4.281 | 103.006 | 16.69 | 4 | 4 | 0.053 | 26 | 406.243 | 156.772 | 0 | 0 | 28.063 | 16.24 | 2.003 | 1,236.365 | 0.504 | 3.074 | false | 0 | C(=N/c1ccccn1)\c1ccc2nc3ccccc3n2c1 | null |
C[C@@H]1CN(C(=O)c2cc(Br)cn2C)CC[C@H]1[NH3+] | 301.208 | 0.8801 | 2 | 1 | 4 | 0.82238 | 2 | 52.88 | 0.094219 | 0.912624 | 0.754264 | 0.060961 | 0.057163 | 0.082361 | 0.002276 | 0.472997 | 0.124003 | 0.591872 | 0.023473 | 0.015037 | 0.007581 | 0.055507 | 0.993503 | 0.005837 | 0.024237 | 0.009255 | 0.004187 | 0.003247 | 0.108546 | 0.000063 | 0.917931 | 0.01885 | 0.019483 | 0.000507 | 0.001884 | 0.000167 | 0.000585 | 0.639737 | 0.458504 | -4.52627 | 55.815803 | 14.400295 | -4.632743 | -12.194158 | 2.687357 | 0.699602 | 40.499968 | -0.909952 | -3.483907 | 40.75223 | 31.71772 | 16.382319 | 36.680884 | 63.8038 | 91.818534 | 68.863901 | 32.648313 | 32.027918 | 69.406747 | 43.427685 | 54.245832 | 40.480807 | 29.895308 | 14.889492 | 84.528887 | 66.22722 | 59.98449 | 39.666537 | 6.281504 | 10.003877 | 13.105855 | 45.754168 | 35.246219 | 50.523459 | 34.43195 | 29.042264 | 15.354789 | 59.364095 | 7.599845 | 70.880186 | 31.05855 | 16.362931 | 16.556805 | 16.207832 | 3.799922 | 8.95696 | 70.221016 | 61.496704 | 78.751454 | 67.119038 | 45.715394 | 28.150446 | 26.444358 | 60.837534 | 37.146181 | 14.424195 | 84.645211 | 14.152772 | [
{
"HBA": 3,
"HBD": 0,
"LogP": 1.1752,
"MW": 286.17300000000006,
"TPSA": 28.48,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1706791",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5681818181818182,
"smiles": "CN1CCN(C(=O)c2cc(Br)cn2C)CC1",
"source": "ChEMBL",
"standard_inchi_key": "DVZVOXPJADABCE-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 0,
"LogP": 1.9126999999999998,
"MW": 345.2370000000001,
"TPSA": 43.7,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4984752",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5555555555555556,
"smiles": "COCCOC[C@H]1CCN(C(=O)c2cc(Br)cn2C)C1",
"source": "ChEMBL",
"standard_inchi_key": "ABVWYEQNHILFAK-NSHDSACASA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 1,
"LogP": 1.3845,
"MW": 299.1680000000001,
"TPSA": 45.47,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL5012401",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5306122448979592,
"smiles": "Cn1cc(Br)cc1C(=O)N1CC(O)(C2CC2)C1",
"source": "ChEMBL",
"standard_inchi_key": "HHUYHHQPNICUFG-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 1,
"LogP": 0.6193000000000002,
"MW": 303.15600000000006,
"TPSA": 54.7,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4932087",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5098039215686274,
"smiles": "CO[C@H]1CN(C(=O)c2cc(Br)cn2C)C[C@@H]1O",
"source": "ChEMBL",
"standard_inchi_key": "MFRSCFVWVPPSOO-UWVGGRQHSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 4 | 1 | 1 | 2 | 52.88 | 0.88 | 69.474 | 23.833 | 2 | 1 | 0.583 | 17 | 301.208 | 109.893 | 1 | 0 | 6.924 | 12.642 | 2.13 | 429.385 | 0.822 | 3.948 | false | 0 | O=C(c1ccc[nH]1)N1CCCCC1 | null |
CCOc1ccc(OCC)c([C@H]2C(C#N)=C(N)N(c3ccccc3C(F)(F)F)C3=C2C(=O)CCC3)c1 | 497.517 | 5.80758 | 6 | 1 | 3 | 0.542126 | 1 | 88.58 | 0.157305 | 0.808701 | 0.887278 | 0.118508 | 0.701958 | 0.092215 | 0.732837 | 0.072434 | 0.055128 | 0.789496 | 0.905241 | 0.465727 | 0.040032 | 0.745118 | 0.999865 | 0.034829 | 0.024007 | 0.161198 | 0.449116 | 0.024176 | 0.02687 | 0.146175 | 0.797472 | 0.925718 | 0.552871 | 0.028986 | 0.143492 | 0.961269 | 0.557066 | 0.135378 | 0.783584 | -4.640008 | 81.900685 | 61.910286 | 21.284963 | -4.673706 | 3.981269 | 3.301707 | 94.95018 | -6.35401 | 6.244851 | 81.388135 | 93.330748 | 69.503684 | 36.680884 | 20.918961 | 53.043815 | 54.808065 | 59.635518 | 45.211322 | 56.649864 | 69.60062 | 62.427297 | 91.120589 | 33.385033 | 95.540907 | 41.139977 | 52.074447 | 86.467623 | 95.075611 | 86.816596 | 31.756495 | 67.506786 | 83.637069 | 78.906553 | 50.174486 | 78.480031 | 96.122528 | 58.782474 | 10.430399 | 93.447073 | 53.974409 | 95.579682 | 86.27375 | 73.322993 | 88.871656 | 99.26328 | 97.053121 | 11.128344 | 77.084141 | 71.423032 | 83.365646 | 83.714618 | 68.127181 | 90.30632 | 97.440869 | 86.622722 | 82.628926 | 3.218302 | 81.271811 | [
{
"HBA": 6,
"HBD": 1,
"LogP": 2.6620800000000013,
"MW": 352.43800000000016,
"TPSA": 82.59,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1399367",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5526315789473685,
"smiles": "CCOc1ccccc1C1C(C#N)=C(N)N(N(C)C)C2=C1C(=O)CCC2",
"source": "ChEMBL",
"standard_inchi_key": "KAFOFPAACXAPNS-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 7,
"HBD": 1,
"LogP": 4.819880000000004,
"MW": 458.5620000000003,
"TPSA": 101.47,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1343791",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5232558139534884,
"smiles": "CCOc1ccc(OCC)c(C2C(C#N)=C(N)N(c3cccnc3)C3=C2C(=O)CC(C)(C)C3)c1",
"source": "ChEMBL",
"standard_inchi_key": "KAQWNDYSAWKCFM-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 2 | 6 | 1 | 6 | 88.58 | 5.808 | 128.154 | 50.155 | 4 | 2 | 0.333 | 36 | 497.517 | 206.949 | 0 | 1 | 12.133 | 25.172 | 2.017 | 1,291.145 | 0.542 | 3.173 | false | 1 | O=C1CCCC2=C1[C@@H](c1ccccc1)C=CN2c1ccccc1 | null |
Cc1ccc2nc(S[C@H](C)C(=O)NC3CCC(C)CC3)n(C)c(=O)c2c1 | 373.522 | 3.41742 | 5 | 1 | 4 | 0.658801 | 1 | 63.99 | 0.174083 | 0.942451 | 0.908362 | 0.38101 | 0.854072 | 0.695358 | 0.64173 | 0.170964 | 0.035321 | 0.818601 | 0.914525 | 0.173982 | 0.08875 | 0.705698 | 0.999977 | 0.01503 | 0.041655 | 0.22356 | 0.182797 | 0.033095 | 0.205111 | 0.053954 | 0.981641 | 0.601838 | 0.630312 | 0.089014 | 0.182545 | 0.40403 | 0.029795 | 0.329692 | 0.435448 | -5.096346 | 69.525855 | 70.839264 | 25.844202 | -8.183772 | 2.430029 | 3.425736 | 87.349055 | -4.11979 | -0.158041 | 59.24777 | 68.28228 | 59.112059 | 36.680884 | 63.8038 | 68.398604 | 54.808065 | 42.07057 | 47.809228 | 74.641334 | 76.114773 | 79.333075 | 95.773556 | 98.875533 | 93.679721 | 62.310973 | 44.978674 | 90.577743 | 95.540907 | 53.74176 | 48.274525 | 65.102753 | 93.679721 | 58.898798 | 68.631252 | 83.249321 | 83.869717 | 67.351687 | 80.573866 | 84.839085 | 92.749128 | 79.95347 | 89.724699 | 86.816596 | 91.392012 | 81.930981 | 55.719271 | 38.813494 | 60.449787 | 42.768515 | 76.657619 | 87.475766 | 72.780147 | 64.598682 | 43.46646 | 88.522683 | 68.359829 | 29.352462 | 35.091121 | [
{
"HBA": 5,
"HBD": 1,
"LogP": 3.1090000000000018,
"MW": 359.4950000000002,
"TPSA": 63.99,
"activity": 5.3819519032879075,
"activity_nm": 4150,
"activity_type": "IC50",
"bindingdb_id": "89429.0",
"chembl_id": null,
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": "KLESNENNFKQDSG-UHFFFAOYSA-N",
"pdb_id": null,
"pmid": null,
"pubchem_cid": "24978826.0",
"similarity": 0.5606060606060606,
"smiles": "CC(Sc1nc2ccccc2c(=O)n1C)C(=O)NC1CCCCC1C",
"source": "BindingDB",
"standard_inchi_key": null,
"target_name": "Protein Wnt-3a",
"target_organism": "Mus musculus",
"uniprot_id": "P27467"
},
{
"HBA": 5,
"HBD": 1,
"LogP": 3.2018000000000013,
"MW": 359.4950000000001,
"TPSA": 63.99,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1887215",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5373134328358209,
"smiles": "CC(C)CCn1c(SC(C)C(=O)NC2CC2)nc2ccccc2c1=O",
"source": "ChEMBL",
"standard_inchi_key": "NUDZLARPVSDXPP-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 6,
"HBD": 1,
"LogP": 2.1922000000000006,
"MW": 361.4670000000001,
"TPSA": 73.22,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1900563",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5070422535211268,
"smiles": "COCCCn1c(SC(C)C(=O)NC2CC2)nc2ccccc2c1=O",
"source": "ChEMBL",
"standard_inchi_key": "RUCQKGRJCWZEIE-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 6,
"HBD": 1,
"LogP": 2.9708000000000014,
"MW": 389.5210000000002,
"TPSA": 73.22,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1715159",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5,
"smiles": "CC(C)OCCCn1c(SC(C)C(=O)NC2CC2)nc2ccccc2c1=O",
"source": "ChEMBL",
"standard_inchi_key": "MVJVJXJRTLPYOL-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 4 | 4 | 1 | 5 | 63.99 | 3.417 | 106.603 | 45.094 | 3 | 2 | 0.55 | 26 | 373.522 | 158.132 | 0 | 0 | 30.315 | 18.956 | 1.732 | 869.221 | 0.659 | 2.692 | false | 0 | O=C(CSc1nc2ccccc2c(=O)[nH]1)NC1CCCCC1 | null |
O=C(N1CCc2c(F)ccc(F)c2C1)C1(O)Cc2ccccc2C1 | 329.346 | 2.3794 | 2 | 1 | 4 | 0.872616 | 0 | 40.54 | 0.478528 | 0.987841 | 0.922644 | 0.798355 | 0.982652 | 0.617717 | 0.850243 | 0.372626 | 0.290593 | 0.766371 | 0.587498 | 0.191108 | 0.09961 | 0.476098 | 0.999992 | 0.015392 | 0.050118 | 0.204623 | 0.155142 | 0.010583 | 0.223294 | 0.014992 | 0.979368 | 0.64129 | 0.196666 | 0.024853 | 0.010288 | 0.47407 | 0.018434 | 0.505432 | 0.891573 | -4.370485 | 62.686175 | 22.838685 | 23.882769 | -9.12179 | 3.258626 | 2.556198 | 71.938163 | -3.165897 | -6.343402 | 49.011245 | 51.143854 | 16.382319 | 36.680884 | 63.8038 | 97.20822 | 22.489337 | 23.691353 | 81.194261 | 90.112447 | 81.000388 | 92.167507 | 99.418379 | 97.169446 | 97.479643 | 78.945328 | 78.324932 | 83.210547 | 83.520744 | 57.231485 | 51.066305 | 52.617294 | 97.28577 | 59.751842 | 73.206669 | 81.930981 | 80.767739 | 37.262505 | 82.706475 | 67.312912 | 91.857309 | 81.814657 | 60.798759 | 71.112834 | 44.164405 | 84.567662 | 47.499031 | 58.472276 | 85.924777 | 88.32881 | 72.353625 | 55.79682 | 70.569988 | 55.525397 | 88.134936 | 71.423032 | 46.064366 | 47.343932 | 5.312136 | [
{
"HBA": 2,
"HBD": 1,
"LogP": 2.1437,
"MW": 307.39300000000003,
"TPSA": 40.540000000000006,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL3457460",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.625,
"smiles": "O=C(N1CCc2ccccc2CC1)C1(O)Cc2ccccc2C1",
"source": "ChEMBL",
"standard_inchi_key": "NFBWEWFXDMKUCK-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 1,
"HBD": 0,
"LogP": 1.8694,
"MW": 211.21099999999998,
"TPSA": 20.310000000000002,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4557412",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5476190476190477,
"smiles": "CC(=O)N1CCc2c(F)ccc(F)c2C1",
"source": "ChEMBL",
"standard_inchi_key": "ADJTUJMXNXYPAQ-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 2 | 1 | 1 | 2 | 40.54 | 2.379 | 84.279 | 22.254 | 4 | 2 | 0.316 | 24 | 329.346 | 138.078 | 0 | 0 | 24.265 | 15.269 | 1.596 | 809.112 | 0.873 | 2.733 | false | 0 | O=C(C1Cc2ccccc2C1)N1CCc2ccccc2C1 | null |
Cc1ccccc1C(=O)N1CCC2(CC1)C[C@H](c1ccccc1)C(=O)N2C | 362.473 | 3.61572 | 2 | 0 | 4 | 0.818714 | 1 | 40.62 | 0.097231 | 0.962111 | 0.828851 | 0.022067 | 0.336532 | 0.340004 | 0.130541 | 0.264643 | 0.037279 | 0.81952 | 0.59276 | 0.0627 | 0.210832 | 0.308118 | 0.999746 | 0.007792 | 0.047239 | 0.007788 | 0.012282 | 0.005374 | 0.126537 | 0.001354 | 0.990663 | 0.635074 | 0.15139 | 0.003055 | 0.010766 | 0.012093 | 0.003126 | 0.400298 | 0.68033 | -4.567288 | 57.096693 | 30.059096 | 5.953789 | -8.055787 | 2.72814 | 2.562474 | 77.848542 | -3.358832 | -4.418055 | 56.766188 | 71.539356 | 16.382319 | 11.768127 | 63.8038 | 91.353238 | 54.808065 | 23.827065 | 32.803412 | 79.216751 | 55.79682 | 42.535867 | 75.300504 | 82.473827 | 69.60062 | 71.849554 | 45.986817 | 90.732842 | 83.637069 | 24.89337 | 67.778209 | 40.67468 | 78.324932 | 41.4114 | 71.267933 | 31.950368 | 40.519581 | 23.303606 | 65.180302 | 29.197363 | 98.022489 | 81.504459 | 54.207057 | 37.921675 | 44.901124 | 35.789066 | 23.032183 | 47.57658 | 71.151609 | 76.114773 | 68.514928 | 61.962001 | 47.886778 | 65.761923 | 63.396665 | 71.65568 | 53.547887 | 43.660333 | 10.391625 | [
{
"HBA": 4,
"HBD": 0,
"LogP": 2.603720000000001,
"MW": 353.422,
"TPSA": 66.65,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL3444716",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.7090909090909091,
"smiles": "Cc1oncc1C(=O)N1CCC2(CC1)CC(c1ccccc1)C(=O)N2C",
"source": "ChEMBL",
"standard_inchi_key": "AMSSQLZHPOZCEX-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 2,
"HBD": 0,
"LogP": 3.4464000000000024,
"MW": 366.43600000000004,
"TPSA": 40.620000000000005,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL5008028",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6792452830188679,
"smiles": "CN1C(=O)[C@@H](c2ccccc2)CC12CCN(C(=O)c1ccc(F)cc1)CC2",
"source": "ChEMBL",
"standard_inchi_key": "KZMPTVWLJZPBNW-LJQANCHMSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 0,
"LogP": 1.8343,
"MW": 370.4970000000001,
"TPSA": 47.1,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4995248",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6666666666666666,
"smiles": "CN1CCN(C(=O)N2CCC3(CC2)C[C@H](c2ccccc2)C(=O)N3C)CC1",
"source": "ChEMBL",
"standard_inchi_key": "OTZDSZWHOIXEON-GOSISDBHSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 1,
"LogP": 3.012900000000001,
"MW": 364.44500000000005,
"TPSA": 60.85000000000001,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4954787",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6545454545454545,
"smiles": "CN1C(=O)[C@@H](c2ccccc2)CC12CCN(C(=O)c1cccc(O)c1)CC2",
"source": "ChEMBL",
"standard_inchi_key": "LVZSAKSEBCOATN-LJQANCHMSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 0,
"LogP": 3.178980000000002,
"MW": 373.4560000000001,
"TPSA": 64.41,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4920323",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6428571428571429,
"smiles": "CN1C(=O)[C@@H](c2ccccc2)CC12CCN(C(=O)c1ccc(C#N)cc1)CC2",
"source": "ChEMBL",
"standard_inchi_key": "XQMZDOJMPOSFIF-HXUWFJFHSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 2 | 0 | 2 | 40.62 | 3.616 | 105.618 | 46.665 | 4 | 2 | 0.391 | 27 | 362.473 | 160.334 | 0 | 0 | 48.531 | 17.777 | 1.49 | 853.692 | 0.819 | 3.35 | false | 0 | O=C1NC2(CCN(C(=O)c3ccccc3)CC2)C[C@@H]1c1ccccc1 | null |
CCCc1cc(NC(=O)CN2C(=O)NC3(CCC(C)CC3)C2=O)n(C)n1 | 361.446 | 1.8118 | 5 | 2 | 4 | 0.781913 | 0 | 96.33 | 0.268264 | 0.981247 | 0.945384 | 0.009289 | 0.134479 | 0.421949 | 0.05677 | 0.083714 | 0.001917 | 0.666716 | 0.18228 | 0.240833 | 0.360877 | 0.878938 | 0.999939 | 0.001673 | 0.028271 | 0.010683 | 0.025983 | 0.002995 | 0.047688 | 0.003471 | 0.921739 | 0.037043 | 0.297523 | 0.004191 | 0.010814 | 0.047792 | 0.025829 | 0.298772 | 0.109107 | -4.798918 | 39.50558 | 41.221453 | 20.589247 | -10.588522 | 3.087976 | 2.275712 | 88.820594 | -4.143122 | 8.653766 | 56.417216 | 42.923614 | 59.112059 | 60.856921 | 63.8038 | 86.351299 | 22.489337 | 65.374176 | 62.69872 | 86.661497 | 88.018612 | 32.919736 | 54.633579 | 88.832881 | 55.835595 | 44.241954 | 10.081427 | 68.825126 | 64.482358 | 64.986429 | 80.263668 | 79.061652 | 88.057387 | 14.618069 | 56.61109 | 36.370686 | 50.523459 | 14.501745 | 25.009694 | 44.009306 | 71.810779 | 38.813494 | 71.151609 | 43.001163 | 45.094998 | 53.586661 | 53.315238 | 35.16867 | 31.097325 | 61.419155 | 53.276464 | 71.810779 | 67.62311 | 40.67468 | 82.784025 | 65.878247 | 71.151609 | 28.848391 | 88.561458 | [
{
"HBA": 3,
"HBD": 2,
"LogP": 2.2649,
"MW": 333.36300000000006,
"TPSA": 78.51,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": "74271.0",
"chembl_id": null,
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": "URROLGIMBBWEGH-UHFFFAOYSA-N",
"pdb_id": null,
"pmid": null,
"pubchem_cid": "2578364.0",
"similarity": 0.5666666666666667,
"smiles": "CC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccc(F)cc1)C2=O",
"source": "BindingDB",
"standard_inchi_key": null,
"target_name": "Protein LANA1",
"target_organism": "Human herpesvirus 8",
"uniprot_id": "Q9QR71"
},
{
"HBA": 4,
"HBD": 3,
"LogP": 1.2246999999999997,
"MW": 358.39800000000014,
"TPSA": 121.6,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2145097",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5483870967741935,
"smiles": "CC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccc(C(N)=O)cc1)C2=O",
"source": "ChEMBL",
"standard_inchi_key": "FWVCRDMYNAPWMJ-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 5,
"HBD": 4,
"LogP": 1.7076999999999996,
"MW": 371.3970000000001,
"TPSA": 127.42000000000002,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1325977",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5373134328358209,
"smiles": "CC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccc3[nH]c(O)nc3c1)C2=O",
"source": "ChEMBL",
"standard_inchi_key": "PBCBBUJGUMSRHL-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 2,
"LogP": 1.1656,
"MW": 321.29900000000004,
"TPSA": 78.51,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4588550",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5333333333333333,
"smiles": "CC1CCC2(CC1)NC(=O)N(CC(=O)NCC(F)(F)F)C2=O",
"source": "ChEMBL",
"standard_inchi_key": "JTYATNIOPWAGGQ-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 2,
"LogP": 3.116100000000002,
"MW": 398.5070000000003,
"TPSA": 81.75,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2361284",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5230769230769231,
"smiles": "CC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccc(N3CCCCC3)cc1)C2=O",
"source": "ChEMBL",
"standard_inchi_key": "VPJOTMZREIKUMM-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 5 | 2 | 5 | 96.33 | 1.812 | 96.44 | 51.646 | 3 | 1 | 0.667 | 26 | 361.446 | 152.845 | 0 | 0 | 20.268 | 18.412 | 1.639 | 718.409 | 0.782 | 3.078 | false | 0 | O=C(CN1C(=O)NC2(CCCCC2)C1=O)Nc1ccn[nH]1 | null |
CC(C)Cc1nc(SCC(=O)NC[C@@H]2CCCO2)c2c(=O)n(C)c(=O)n(C)c2n1 | 421.523 | 0.613 | 9 | 1 | 4 | 0.515466 | 1 | 108.11 | 0.452517 | 0.896263 | 0.9169 | 0.073581 | 0.098219 | 0.322966 | 0.174921 | 0.135929 | 0.002813 | 0.78895 | 0.374022 | 0.055197 | 0.252697 | 0.938102 | 0.999236 | 0.009529 | 0.012797 | 0.018338 | 0.057437 | 0.019042 | 0.060279 | 0.028783 | 0.978989 | 0.595794 | 0.253302 | 0.019051 | 0.026711 | 0.007386 | 0.036182 | 0.37359 | 0.432357 | -5.321176 | 67.688364 | 59.997 | 15.888049 | -10.895586 | 2.631488 | 1.478672 | 68.278732 | -3.40484 | -1.637709 | 70.104692 | 28.964715 | 86.254362 | 36.680884 | 63.8038 | 48.933695 | 54.808065 | 72.198527 | 79.759597 | 67.041489 | 79.022877 | 56.262117 | 49.166344 | 80.69019 | 74.098488 | 56.766188 | 12.834432 | 86.390074 | 75.18418 | 22.10159 | 72.159752 | 86.777821 | 68.592478 | 46.374564 | 30.942226 | 45.637844 | 63.706863 | 51.996898 | 33.152385 | 76.696394 | 91.740985 | 79.526948 | 66.88639 | 67.119038 | 63.164017 | 30.39938 | 59.674292 | 44.280729 | 60.333463 | 30.593253 | 75.610702 | 82.628926 | 62.194649 | 37.572703 | 56.882513 | 50.019387 | 41.295076 | 42.690965 | 24.15665 | [
{
"HBA": 9,
"HBD": 1,
"LogP": 0.6130000000000004,
"MW": 421.52300000000014,
"TPSA": 108.11,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1468525",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 1,
"smiles": "CC(C)Cc1nc(SCC(=O)NCC2CCCO2)c2c(=O)n(C)c(=O)n(C)c2n1",
"source": "ChEMBL",
"standard_inchi_key": "FXANQMMTONEGRR-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 9,
"HBD": 1,
"LogP": -0.023099999999999232,
"MW": 393.4690000000001,
"TPSA": 108.11,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1309394",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.8225806451612904,
"smiles": "CCc1nc(SCC(=O)NCC2CCCO2)c2c(=O)n(C)c(=O)n(C)c2n1",
"source": "ChEMBL",
"standard_inchi_key": "RKDSYRMDRIXJKQ-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 9,
"HBD": 1,
"LogP": 0.36700000000000044,
"MW": 407.49600000000015,
"TPSA": 108.11,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1468004",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.796875,
"smiles": "CCCc1nc(SCC(=O)NCC2CCCO2)c2c(=O)n(C)c(=O)n(C)c2n1",
"source": "ChEMBL",
"standard_inchi_key": "PSEAYZCMAVMHHF-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 9,
"HBD": 1,
"LogP": 1.0031,
"MW": 435.55000000000024,
"TPSA": 108.10999999999999,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1595812",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.7846153846153846,
"smiles": "Cn1c(=O)c2c(SCC(=O)NCC3CCCO3)nc(CC(C)(C)C)nc2n(C)c1=O",
"source": "ChEMBL",
"standard_inchi_key": "IEVLFKPXGCHFAA-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 9,
"HBD": 1,
"LogP": 0.5379000000000007,
"MW": 407.49600000000015,
"TPSA": 108.11,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1425449",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.78125,
"smiles": "CC(C)c1nc(SCC(=O)NCC2CCCO2)c2c(=O)n(C)c(=O)n(C)c2n1",
"source": "ChEMBL",
"standard_inchi_key": "HLFPXCAIKVTNGH-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 7 | 1 | 9 | 108.11 | 0.613 | 111.27 | 32.514 | 3 | 2 | 0.632 | 29 | 421.523 | 172.421 | 0 | 0 | 25.609 | 21.507 | 1.887 | 1,023.902 | 0.515 | 3.113 | false | 0 | O=C(CSc1ncnc2[nH]c(=O)[nH]c(=O)c12)NC[C@@H]1CCCO1 | null |
Cc1ccc(CNC(=O)c2ccccc2NC(=O)[C@@H]2CC(=O)N(c3ccc(C)cc3)C2)cc1 | 441.531 | 4.22504 | 3 | 2 | 4 | 0.601076 | 1 | 78.51 | 0.163247 | 0.657392 | 0.799981 | 0.088812 | 0.813818 | 0.54478 | 0.757891 | 0.162807 | 0.076546 | 0.831071 | 0.9144 | 0.59033 | 0.204165 | 0.911558 | 0.996256 | 0.009289 | 0.028891 | 0.146569 | 0.060061 | 0.007756 | 0.072389 | 0.071728 | 0.827216 | 0.872301 | 0.609403 | 0.039409 | 0.146924 | 0.650944 | 0.148919 | 0.271464 | 0.8593 | -4.985174 | 67.481094 | 56.268848 | 44.068137 | -8.441254 | 3.00125 | 2.972927 | 95.572835 | -5.506234 | -1.538499 | 73.943389 | 80.651415 | 31.174874 | 60.856921 | 63.8038 | 60.837534 | 54.808065 | 52.578519 | 46.297014 | 42.923614 | 50.911206 | 58.704924 | 94.649089 | 95.15316 | 95.773556 | 60.837534 | 57.502908 | 92.322606 | 95.502133 | 92.36138 | 67.119038 | 82.784025 | 51.570376 | 45.754168 | 57.386584 | 77.316789 | 64.637456 | 29.507561 | 40.907328 | 88.134936 | 57.464133 | 91.469562 | 88.98798 | 77.23924 | 89.026755 | 91.081815 | 80.806514 | 31.601396 | 82.512602 | 49.70919 | 75.416828 | 81.388135 | 84.683986 | 62.078325 | 78.673905 | 80.186119 | 83.714618 | 8.646762 | 24.738271 | [
{
"HBA": 5,
"HBD": 2,
"LogP": 4.015500000000003,
"MW": 487.5560000000003,
"TPSA": 96.97,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4995245",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.734375,
"smiles": "CCOc1ccc(N2C[C@@H](C(=O)Nc3ccccc3C(=O)NCc3ccc(OC)cc3)CC2=O)cc1",
"source": "ChEMBL",
"standard_inchi_key": "SNTTTXXUMJHBSV-FQEVSTJZSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 1,
"LogP": 2.773220000000001,
"MW": 352.3900000000001,
"TPSA": 75.71,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1568039",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.7017543859649122,
"smiles": "COC(=O)c1ccccc1NC(=O)C1CC(=O)N(c2ccc(C)cc2)C1",
"source": "ChEMBL",
"standard_inchi_key": "ROFVNIYIKFWBOF-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 3,
"LogP": 1.7972,
"MW": 339.35100000000006,
"TPSA": 98.74,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": null,
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.631578947368421,
"smiles": "O=C(NO)c1ccccc1NC(=O)C1CC(=O)N(c2ccccc2)C1",
"source": "PubChem",
"standard_inchi_key": null,
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 1,
"LogP": 3.586820000000002,
"MW": 363.46100000000024,
"TPSA": 52.650000000000006,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1715433",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6271186440677966,
"smiles": "Cc1ccc(N2CC(C(=O)Nc3ccccc3N3CCCC3)CC2=O)cc1",
"source": "ChEMBL",
"standard_inchi_key": "PDDFMXXRWAEABA-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 2,
"LogP": 3.206500000000002,
"MW": 379.46000000000004,
"TPSA": 78.51,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": null,
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6166666666666667,
"smiles": "CC(C)(C)NC(=O)c1ccccc1NC(=O)C1CC(=O)N(c2ccccc2)C1",
"source": "PubChem",
"standard_inchi_key": null,
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 6 | 2 | 3 | 78.51 | 4.225 | 129.06 | 33.469 | 4 | 3 | 0.222 | 33 | 441.531 | 193.168 | 0 | 0 | 59.658 | 22.271 | 1.41 | 1,169.976 | 0.601 | 2.429 | false | 0 | O=C(NCc1ccccc1)c1ccccc1NC(=O)[C@@H]1CC(=O)N(c2ccccc2)C1 | null |
CCCCC(=O)NC(=S)Nc1ccccc1C(=O)N1CCOCC1 | 349.456 | 2.1622 | 4 | 2 | 4 | 0.7974 | 0 | 70.67 | 0.212289 | 0.957713 | 0.871489 | 0.231318 | 0.556468 | 0.313597 | 0.435443 | 0.105742 | 0.004272 | 0.471901 | 0.147719 | 0.210152 | 0.159754 | 0.887685 | 0.999102 | 0.015049 | 0.034578 | 0.096553 | 0.05407 | 0.007452 | 0.116325 | 0.035493 | 0.956311 | 0.073539 | 0.190273 | 0.044472 | 0.100546 | 0.078791 | 0.089037 | 0.556014 | 0.420761 | -4.706788 | 64.909731 | 11.73135 | 12.963414 | -11.736502 | 2.432298 | 1.814185 | 61.71679 | -3.708571 | 4.657764 | 53.470337 | 47.848003 | 46.471501 | 60.856921 | 63.8038 | 88.639007 | 22.489337 | 46.684762 | 54.051958 | 78.014734 | 65.4905 | 72.198527 | 86.079876 | 79.759597 | 88.212485 | 50.213261 | 16.324157 | 48.778596 | 61.302831 | 59.868166 | 61.574254 | 79.875921 | 67.002714 | 58.976347 | 63.086468 | 71.345483 | 62.504847 | 28.732067 | 62.000775 | 79.2943 | 82.00853 | 47.460256 | 60.023265 | 79.022877 | 84.955409 | 60.488561 | 74.253587 | 62.853819 | 59.674292 | 67.157813 | 73.516867 | 42.458317 | 58.549826 | 29.546336 | 43.582784 | 56.53354 | 32.997286 | 37.417604 | 72.586274 | [
{
"HBA": 3,
"HBD": 1,
"LogP": 2.2877,
"MW": 290.36300000000006,
"TPSA": 58.64,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL2135323",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.8125,
"smiles": "CCCCC(=O)Nc1ccccc1C(=O)N1CCOCC1",
"source": "ChEMBL",
"standard_inchi_key": "QDBGZZYBUFTYAJ-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 3,
"HBD": 1,
"LogP": 1.5075,
"MW": 262.30899999999997,
"TPSA": 58.64,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1548575",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.66,
"smiles": "CCC(=O)Nc1ccccc1C(=O)N1CCOCC1",
"source": "ChEMBL",
"standard_inchi_key": "RBVYCDQIUXSYIR-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 2,
"LogP": 1.3524,
"MW": 320.3450000000002,
"TPSA": 95.94,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1559631",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6415094339622641,
"smiles": "O=C(O)CCCC(=O)Nc1ccccc1C(=O)N1CCOCC1",
"source": "ChEMBL",
"standard_inchi_key": "DIGGMRQJOKUONH-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 1,
"LogP": 2.507600000000001,
"MW": 306.36200000000014,
"TPSA": 67.87,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1716043",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6363636363636364,
"smiles": "CCCCOC(=O)Nc1ccccc1C(=O)N1CCOCC1",
"source": "ChEMBL",
"standard_inchi_key": "RGHSQYUXGNSHJG-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 4,
"HBD": 2,
"LogP": 2.1363000000000003,
"MW": 307.41900000000015,
"TPSA": 53.60000000000001,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1422836",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6181818181818182,
"smiles": "CCCC(=O)NC(=S)Nc1ccccc1N1CCOCC1",
"source": "ChEMBL",
"standard_inchi_key": "UUVOCTVOYCAMBB-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 5 | 2 | 4 | 70.67 | 2.162 | 97.053 | 36.544 | 2 | 1 | 0.471 | 24 | 349.456 | 147.095 | 0 | 1 | 25.477 | 18.35 | 2.011 | 600.498 | 0.797 | 2.038 | false | 0 | O=C(c1ccccc1)N1CCOCC1 | null |
Cc1c(NC(=O)CSc2nc3sc4c(c3c(=O)[nH]2)CCCC4)c(=O)n(-c2ccccc2)n1C | 481.603 | 3.39202 | 8 | 2 | 4 | 0.336093 | 0 | 101.78 | 0.20985 | 0.749745 | 0.817281 | 0.232139 | 0.687284 | 0.69577 | 0.854486 | 0.154452 | 0.08381 | 0.713063 | 0.773054 | 0.345326 | 0.221795 | 0.936359 | 0.997051 | 0.030863 | 0.057944 | 0.154032 | 0.088758 | 0.020272 | 0.133646 | 0.126236 | 0.758937 | 0.851513 | 0.36964 | 0.254065 | 0.063821 | 0.601084 | 0.195122 | 0.258834 | 0.759277 | -5.767915 | 71.922259 | 55.188359 | 71.759587 | -11.793821 | 2.851043 | 2.313346 | 88.561186 | -3.16327 | 0.107003 | 79.875921 | 67.739434 | 82.357503 | 60.856921 | 63.8038 | 25.823963 | 22.489337 | 68.592478 | 53.392788 | 51.182629 | 53.74176 | 72.276076 | 90.616518 | 98.875533 | 97.595967 | 59.596743 | 58.860023 | 75.067856 | 90.073672 | 77.549438 | 68.863901 | 86.390074 | 53.858085 | 76.851493 | 76.890268 | 78.053509 | 71.267933 | 53.74176 | 66.498643 | 92.787902 | 50.523459 | 90.538969 | 75.882125 | 95.502133 | 78.596355 | 89.104304 | 85.071733 | 30.050407 | 75.882125 | 16.440481 | 78.324932 | 80.535091 | 92.089957 | 29.00349 | 70.918961 | 66.614967 | 70.608763 | 47.382706 | 37.611477 | [
{
"HBA": 7,
"HBD": 2,
"LogP": 3.3808000000000025,
"MW": 429.52300000000025,
"TPSA": 101.14999999999998,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1395042",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6103896103896104,
"smiles": "COC(=O)c1ccccc1NC(=O)CSc1nc2sc3c(c2c(=O)[nH]1)CCCC3",
"source": "ChEMBL",
"standard_inchi_key": "FHKNLUUZAQJIGD-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 6,
"HBD": 2,
"LogP": 3.091520000000002,
"MW": 393.47200000000015,
"TPSA": 84.71000000000001,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1376113",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.6027397260273972,
"smiles": "Cc1c(NC(=O)CSc2nc3ccccc3[nH]2)c(=O)n(-c2ccccc2)n1C",
"source": "ChEMBL",
"standard_inchi_key": "JGMKOJYUIMODNK-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 6,
"HBD": 2,
"LogP": 3.3999400000000017,
"MW": 407.49900000000014,
"TPSA": 84.71,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1468236",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5714285714285714,
"smiles": "Cc1ccc2[nH]c(SCC(=O)Nc3c(C)n(C)n(-c4ccccc4)c3=O)nc2c1",
"source": "ChEMBL",
"standard_inchi_key": "GANKKCSDAXWCPT-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 9,
"HBD": 1,
"LogP": 3.140460000000001,
"MW": 469.5920000000002,
"TPSA": 90.91999999999999,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1359978",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5641025641025641,
"smiles": "Cc1sc2nc(SCC(=O)Nc3c(C)n(C)n(-c4ccccc4)c3=O)n(C)c(=O)c2c1C",
"source": "ChEMBL",
"standard_inchi_key": "GNUULMWCIYPLDD-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
},
{
"HBA": 6,
"HBD": 2,
"LogP": 3.7449200000000014,
"MW": 427.91700000000014,
"TPSA": 84.71000000000001,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL1556460",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5641025641025641,
"smiles": "Cc1c(NC(=O)CSc2nc3cc(Cl)ccc3[nH]2)c(=O)n(-c2ccccc2)n1C",
"source": "ChEMBL",
"standard_inchi_key": "UFENJWUAZNKEIP-UHFFFAOYSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 5 | 5 | 2 | 8 | 101.78 | 3.392 | 131.983 | 28.976 | 5 | 4 | 0.304 | 33 | 481.603 | 197.195 | 0 | 0 | 29.961 | 21.721 | 1.34 | 1,480.012 | 0.336 | 2.622 | false | 0 | O=C(CSc1nc2sc3c(c2c(=O)[nH]1)CCCC3)Nc1c[nH]n(-c2ccccc2)c1=O | null |
CC(C)[C@@H](Oc1cccc(Cl)c1)C(=O)N1CCC(n2cccn2)CC1 | 361.873 | 3.8036 | 4 | 0 | 4 | 0.813268 | 1 | 47.36 | 0.082795 | 0.958064 | 0.9146 | 0.477786 | 0.959933 | 0.228771 | 0.852711 | 0.283428 | 0.262173 | 0.836905 | 0.948044 | 0.090027 | 0.311043 | 0.427975 | 0.999998 | 0.002518 | 0.012582 | 0.127736 | 0.429197 | 0.013069 | 0.177134 | 0.007892 | 0.996094 | 0.726327 | 0.596423 | 0.008172 | 0.038326 | 0.063403 | 0.003139 | 0.333062 | 0.666206 | -4.691362 | 76.506728 | 41.838822 | 7.916188 | -8.386352 | 2.524762 | 2.945877 | 87.658439 | -4.088973 | -0.449222 | 56.494765 | 74.214812 | 46.471501 | 11.768127 | 63.8038 | 90.771617 | 54.808065 | 29.119814 | 29.236138 | 78.169833 | 78.480031 | 82.473827 | 98.487786 | 67.584335 | 97.557193 | 73.322993 | 76.967817 | 93.330748 | 97.324544 | 34.43195 | 77.200465 | 49.476541 | 99.26328 | 19.736332 | 30.515704 | 75.10663 | 95.657231 | 42.380768 | 76.192323 | 57.231485 | 99.767352 | 84.839085 | 88.561458 | 52.656068 | 70.221016 | 56.882513 | 23.070958 | 39.162466 | 70.531214 | 67.933307 | 80.884064 | 72.431175 | 51.066305 | 62.504847 | 49.864288 | 79.37185 | 69.019 | 29.895308 | 32.764637 | [
{
"HBA": 6,
"HBD": 1,
"LogP": 2.0039,
"MW": 357.45800000000014,
"TPSA": 86.27,
"activity": null,
"activity_nm": null,
"activity_type": null,
"bindingdb_id": null,
"chembl_id": "CHEMBL4921276",
"doi": null,
"drugbank_id": null,
"ligand_inchi_key": null,
"pdb_id": null,
"pmid": null,
"pubchem_cid": null,
"similarity": 0.5074626865671642,
"smiles": "CC(C)[C@H](Oc1ccccc1)C(=O)N1CCC(n2cc(CN)nn2)CC1",
"source": "ChEMBL",
"standard_inchi_key": "DYDYHIDCYCKLMC-SFHVURJKSA-N",
"target_name": null,
"target_organism": null,
"uniprot_id": null
}
] | 1 | 5 | 0 | 4 | 47.36 | 3.804 | 97.784 | 32.731 | 3 | 2 | 0.474 | 25 | 361.873 | 153.077 | 0 | 0 | 31.515 | 17.802 | 1.63 | 694.455 | 0.813 | 2.94 | false | 0 | O=C(COc1ccccc1)N1CCC(n2cccn2)CC1 | null |
CCN(CC)C(=O)C[C@@H](C)[NH2+][C@H](C)c1cccc(F)c1F | 299.385 | 2.2362 | 1 | 1 | 4 | 0.823459 | 2 | 36.92 | 0.092639 | 0.929214 | 0.793705 | 0.183232 | 0.178949 | 0.093795 | 0.016287 | 0.339597 | 0.552365 | 0.642356 | 0.329234 | 0.171377 | 0.005537 | 0.021363 | 0.954526 | 0.008481 | 0.027608 | 0.012746 | 0.031161 | 0.017516 | 0.110337 | 0.000151 | 0.946236 | 0.024803 | 0.014935 | 0.000586 | 0.000719 | 0.003492 | 0.000329 | 0.533268 | 0.738246 | -4.315421 | 56.936363 | 41.299798 | 3.316135 | -9.410769 | 2.776056 | 0.016394 | 19.697658 | -1.04589 | 7.522655 | 40.325708 | 49.011245 | 6.649864 | 36.680884 | 63.8038 | 91.934858 | 68.863901 | 18.94145 | 31.71772 | 71.772005 | 49.903063 | 68.902675 | 60.604886 | 33.734005 | 37.456378 | 77.161691 | 87.204343 | 66.033346 | 73.516867 | 53.315238 | 8.569213 | 5.971307 | 30.903451 | 43.272586 | 55.447848 | 38.929818 | 53.509112 | 49.205118 | 60.178364 | 10.856921 | 78.480031 | 34.044203 | 13.532377 | 17.720047 | 7.832493 | 23.41993 | 6.475378 | 61.147732 | 74.214812 | 90.771617 | 68.359829 | 71.927104 | 43.039938 | 52.539744 | 66.110896 | 26.715781 | 5.699884 | 82.590151 | 85.45948 | [] | 0 | 7 | 1 | 1 | 36.92 | 2.236 | 78.705 | 45.721 | 1 | 1 | 0.562 | 21 | 299.385 | 124.883 | 1 | 0 | 6.066 | 17.561 | 2.637 | 475.345 | 0.823 | 3.878 | false | 0 | c1ccccc1 | null |
Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 | 393.516 | 3.81104 | 6 | 1 | 4 | 0.713661 | 0 | 71.01 | 0.226013 | 0.939517 | 0.895728 | 0.366095 | 0.885821 | 0.500093 | 0.679032 | 0.273758 | 0.125324 | 0.867621 | 0.924221 | 0.146502 | 0.14125 | 0.801347 | 0.999845 | 0.019766 | 0.086304 | 0.566264 | 0.095817 | 0.021092 | 0.304282 | 0.032596 | 0.971896 | 0.877218 | 0.614472 | 0.160369 | 0.085043 | 0.269551 | 0.091058 | 0.204908 | 0.680326 | -5.30945 | 77.16784 | 95.182837 | 22.422581 | -8.943799 | 2.673748 | 3.486837 | 93.210475 | -3.775871 | 2.309183 | 64.133385 | 74.253587 | 69.503684 | 36.680884 | 63.8038 | 76.812718 | 22.489337 | 46.762311 | 56.300892 | 74.059713 | 71.888329 | 78.829003 | 96.355176 | 93.175649 | 94.222567 | 72.46995 | 66.537418 | 96.471501 | 95.928655 | 48.119426 | 58.782474 | 71.694455 | 82.784025 | 66.265995 | 84.683986 | 94.106243 | 72.508724 | 54.711128 | 88.677782 | 78.247383 | 88.522683 | 91.740985 | 89.259403 | 92.167507 | 83.016673 | 76.618845 | 74.563784 | 21.287321 | 71.151609 | 31.252423 | 81.116712 | 94.920512 | 69.174098 | 57.309035 | 60.372237 | 89.181853 | 79.410624 | 36.254362 | 56.455991 | [] | 0 | 5 | 1 | 6 | 71.01 | 3.811 | 110.787 | 33.943 | 4 | 3 | 0.333 | 28 | 393.516 | 168.23 | 0 | 1 | 30.332 | 18.558 | 1.463 | 985.716 | 0.714 | 2.546 | false | 0 | O=C(CCc1ccccc1)N1CCc2c(ncnc2Nc2nccs2)C1 | null |
MoleculeBench
Pre-computed molecular property scores for 417,500 unique drug-like molecules from ZINC250K and dockstring, scored with three computational chemistry tools.
Quick Start
import pandas as pd
df = pd.read_parquet("hf://datasets/yoonholee/MoleculeBench/all_results.parquet")
print(df.shape) # (417500, 126)
# Filter drug-like molecules
druglike = df[
(df["admet_ai.QED"] > 0.5) &
(df["rdkit_properties.LipinskiViolations"] == 0) &
(df["admet_ai.BBB_Martins"] > 0.8)
]
Dataset Details
| Molecules | 417,500 unique canonical SMILES |
| Sources | ZINC250K (249K) + dockstring (260K), deduplicated |
| Columns | 126 (1 SMILES + 98 ADMET-AI + 24 RDKit + 3 similarity) |
| Format | Parquet (291 MB) |
Column Reference
ADMET-AI (98 columns)
Predicted with ADMET-AI (Chemprop-RDKit models trained on TDC datasets). Each property has a raw prediction and a DrugBank-approved percentile.
Physicochemical: molecular_weight, logP, hydrogen_bond_acceptors, hydrogen_bond_donors, Lipinski, QED, stereo_centers, tpsa
Absorption: HIA_Hou, Bioavailability_Ma, Caco2_Wang, PAMPA_NCATS, Pgp_Broccatelli, Solubility_AqSolDB, HydrationFreeEnergy_FreeSolv, Lipophilicity_AstraZeneca
Distribution: BBB_Martins, PPBR_AZ, VDss_Lombardo
Metabolism: CYP1A2_Veith, CYP2C9_Veith, CYP2C9_Substrate_CarbonMangels, CYP2C19_Veith, CYP2D6_Veith, CYP2D6_Substrate_CarbonMangels, CYP3A4_Veith, CYP3A4_Substrate_CarbonMangels
Excretion: Clearance_Hepatocyte_AZ, Clearance_Microsome_AZ, Half_Life_Obach
Toxicity: AMES, Carcinogens_Lagunin, ClinTox, DILI, hERG, LD50_Zhu, Skin_Reaction, NR-AR, NR-AR-LBD, NR-AhR, NR-Aromatase, NR-ER, NR-ER-LBD, NR-PPAR-gamma, SR-ARE, SR-ATAD5, SR-HSE, SR-MMP, SR-p53
Each property also has a *_drugbank_approved_percentile column (49 total).
RDKit Properties (24 columns)
Computed with RDKit. Prefixed with rdkit_properties.:
MolWt, LogP, QED, TPSA, HBondDonorCount, HBondAcceptorCount, RotatableBondCount, RingCount, AromaticRingCount, HeavyAtomCount, FractionCSP3, MolarRefractivity, FormalCharge, BasicAmineCount, AccessibleSurfaceArea, SlogP_VSA5, PEOE_VSA6, Kappa1, BalabanJ, BertzCT, SyntheticAccessibility, PAINS, LipinskiViolations, MurckoScaffold
Similarity Search (3 columns)
Nearest neighbors from a FAISS index over ChEMBL/PubChem/BindingDB (~2M compounds):
similarity.similar_compounds— JSON list of top-k neighbors with SMILES, Tanimoto similarity, source database, and metadatasimilarity.count— number of neighbors returnedsimilarity.error— error message if search failed (rare)
Source Datasets
- ZINC250K: 249,455 drug-like molecules from ZINC via the chemical_vae paper
- dockstring: 260,155 molecules from the dockstring benchmark (ExCAPE-DB subset with docking scores for 58 protein targets)
After canonicalization and deduplication, 1,041 overlapping molecules were removed.
Generation
Scored using MoleculeBench, which runs each tool as an isolated HTTP worker service:
uv run moleculebench --start-services
uv run python benchmark_all.py
- Downloads last month
- 12